ChemNet > CAS > 4341-24-6 5-Methylcyclohexane-1,3-dione
4341-24-6 5-Methylcyclohexane-1,3-dione
상품명칭 |
5-Methylcyclohexane-1,3-dione |
영문 이름 |
5-Methylcyclohexane-1,3-dione;(5S)-3-hydroxy-5-methylcyclohex-2-en-1-one |
분자식 |
C7H10O2 |
분자량 |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-5-2-6(8)4-7(9)3-5/h4-5,8H,2-3H2,1H3/t5-/m0/s1 |
cas번호 |
4341-24-6 |
분자 구조 |
|
밀도 |
1.134g/cm3 |
녹는 점 |
129-131℃ |
비등점 |
221.6°C at 760 mmHg |
굴절 지수 |
1.517 |
인화점 |
89.1°C |
증기압 |
0.0219mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|