ChemNet > CAS > 4347-31-3 2-Formylthiophene-3-boronic acid
4347-31-3 2-Formylthiophene-3-boronic acid
| 상품명칭 |
2-Formylthiophene-3-boronic acid |
| 영문 이름 |
2-Formylthiophene-3-boronic acid; 3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
| 분자식 |
C5H5BO3S |
| 분자량 |
155.9674 |
| InChI |
InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
| cas번호 |
4347-31-3 |
| 분자 구조 |
|
| 밀도 |
1.41g/cm3 |
| 녹는 점 |
167-173℃ |
| 비등점 |
396.7°C at 760 mmHg |
| 굴절 지수 |
1.573 |
| 인화점 |
193.7°C |
| 증기압 |
5.27E-07mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
