ChemNet > CAS > 4402-83-9 메틸 3- (2,6- 디클로로 페닐) -5- 메틸 이소 옥사 졸 -4- 카르 복실 레이트
4402-83-9 메틸 3- (2,6- 디클로로 페닐) -5- 메틸 이소 옥사 졸 -4- 카르 복실 레이트
| 상품명칭 |
메틸 3- (2,6- 디클로로 페닐) -5- 메틸 이소 옥사 졸 -4- 카르 복실 레이트 |
| 별명 |
메틸 3- (2,6- 디클로로 페닐) -5- 메틸 -1,2- 옥사 졸 -4- 카르 복실 레이트 |
| 영문 이름 |
methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate;methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| 분자식 |
C12H9Cl2NO3 |
| 분자량 |
286.1108 |
| InChI |
InChI=1/C12H9Cl2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
| cas번호 |
4402-83-9 |
| 분자 구조 |
|
| 밀도 |
1.37g/cm3 |
| 녹는 점 |
115℃ |
| 비등점 |
382.4°C at 760 mmHg |
| 굴절 지수 |
1.561 |
| 인화점 |
185.1°C |
| 증기압 |
4.72E-06mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
