ChemNet > CAS > 4476-28-2 4-Isopropylphenylacetic acid
4476-28-2 4-Isopropylphenylacetic acid
| 상품명칭 |
4-Isopropylphenylacetic acid |
| 영문 이름 |
4-Isopropylphenylacetic acid; AI3-12008; Benzeneacetic acid, 4-(1-methylethyl)-; [4-(propan-2-yl)phenyl]acetic acid; [4-(1-methylethyl)phenyl]acetate |
| 분자식 |
C11H13O2 |
| 분자량 |
177.2203 |
| InChI |
InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| cas번호 |
4476-28-2 |
| EC번호 |
224-755-2 |
| 분자 구조 |
|
| 비등점 |
295°C at 760 mmHg |
| 인화점 |
192.1°C |
| 증기압 |
0.00071mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
