상품명칭 |
L-Lactide S |
영문 이름 |
L-Lactide S; (3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
분자식 |
C6H8O4 |
분자량 |
144.1253 |
InChI |
InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
cas번호 |
4511-42-6 |
EC번호 |
224-832-0 |
분자 구조 |
|
밀도 |
1.186g/cm3 |
녹는 점 |
92-98℃ |
비등점 |
285.5°C at 760 mmHg |
굴절 지수 |
1.429 |
인화점 |
150.6°C |
증기압 |
0.0028mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37:Irritating to eyes and respiratory system.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|