ChemNet > CAS > 452-64-2 1,2-Dimethyl-4-fluorobenzene
452-64-2 1,2-Dimethyl-4-fluorobenzene
상품명칭 |
1,2-Dimethyl-4-fluorobenzene |
영문 이름 |
1,2-Dimethyl-4-fluorobenzene; Fluoroxylene2; Fluorooxylene; 3,4-Dimethylfluorobenzene; 4-(Trifluoromethyl)-o-xylene; 4-fluoro-1,2-dimethylbenzene; 1-fluoro-2,4-dimethylbenzene; 4-Fluoro-o-xylene |
분자식 |
C8H9F |
분자량 |
124.1555 |
InChI |
InChI=1/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
cas번호 |
452-64-2 |
분자 구조 |
|
밀도 |
0.984g/cm3 |
비등점 |
144.62°C at 760 mmHg |
굴절 지수 |
1.481 |
인화점 |
30.873°C |
증기압 |
6.357mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|