ChemNet > CAS > 45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
상품명칭 |
3-Amino-5-methylthio-1H-1,2,4-triazole |
영문 이름 |
3-Amino-5-methylthio-1H-1,2,4-triazole; |
분자식 |
C3H6N4S |
분자량 |
130.1715 |
InChI |
InChI=1/C3H6N4S/c1-8-3-5-2(4)6-7-3/h1H3,(H3,4,5,6,7) |
cas번호 |
45534-08-5 |
EC번호 |
256-242-4 |
분자 구조 |
|
밀도 |
1.46g/cm3 |
녹는 점 |
130-133℃ |
비등점 |
393.7°C at 760 mmHg |
굴절 지수 |
1.652 |
인화점 |
191.9°C |
증기압 |
2.08E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|