ChemNet > CAS > 458-92-4 alpha,alpha-Difluoroanisole
458-92-4 alpha,alpha-Difluoroanisole
| 상품명칭 |
alpha,alpha-Difluoroanisole |
| 영문 이름 |
alpha,alpha-Difluoroanisole; (Difluoromethoxy)benzene |
| 분자식 |
C7H6F2O |
| 분자량 |
144.1187 |
| InChI |
InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
| cas번호 |
458-92-4 |
| EC번호 |
207-283-1 |
| 분자 구조 |
|
| 밀도 |
1.155g/cm3 |
| 비등점 |
138°C at 760 mmHg |
| 굴절 지수 |
1.445 |
| 인화점 |
43.1°C |
| 증기압 |
8.52mmHg at 25°C |
| 리스크 규칙 |
R10:Flammable.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|