상품명칭 |
트랜스-3,6-엔도-메틸렌-1,2,3,6-테트라히드로프탈로일 클로라이드 |
별명 |
; 트랜스-5-노르보르넨-2,3-디카르보닐 클로라이드; 바이시클로[2.2.1]-5-헵텐-2,3-디카르보닐 클로라이드; 바이시클로 [2.2.1] HEPT-5- 엔 -2,3- 디 카르 보닐 디클로라이드; (1R, 2S, 3S, 4S)-바이 시클로 [2.2.1] 헵트 -5- 엔 -2,3- 디 카르 보닐 디클로라이드 |
영문 이름 |
trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride; trans-5-Norbornene-2,3-dicarbonyl chloride; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl Chloride; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
분자식 |
C9H8Cl2O2 |
분자량 |
219.0646 |
InChI |
InChI=1/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4-,5+,6-,7-/m0/s1 |
cas번호 |
4582-21-2 |
EC번호 |
224-967-5 |
분자 구조 |
|
밀도 |
1.453g/cm3 |
비등점 |
243.334°C at 760 mmHg |
굴절 지수 |
1.56 |
인화점 |
133.454°C |
증기압 |
0.032mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|