ChemNet > CAS > 459-05-2 1-(4-fluorophenyl)-2-thiourea
459-05-2 1-(4-fluorophenyl)-2-thiourea
상품명칭 |
1-(4-fluorophenyl)-2-thiourea |
영문 이름 |
1-(4-fluorophenyl)-2-thiourea; 4-Fluorophenylthiourea; 1-(4-fluorophenyl)thiourea |
분자식 |
C7H7FN2S |
분자량 |
170.2073 |
InChI |
InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
cas번호 |
459-05-2 |
분자 구조 |
|
밀도 |
1.397g/cm3 |
녹는 점 |
164℃ |
비등점 |
264.2°C at 760 mmHg |
굴절 지수 |
1.692 |
인화점 |
113.6°C |
증기압 |
0.00987mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R25:Toxic if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|