ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
상품명칭 |
Methyl cyclopentanecarboxylate |
영문 이름 |
Methyl cyclopentanecarboxylate; Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate |
분자식 |
C7H12O2 |
분자량 |
128.169 |
InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
cas번호 |
4630-80-2 |
EC번호 |
225-049-7 |
분자 구조 |
|
밀도 |
1.014g/cm3 |
비등점 |
159°C at 760 mmHg |
굴절 지수 |
1.45 |
인화점 |
43.6°C |
증기압 |
2.55mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|