465514-33-4 (2-모르폴리노페닐)메탄올
상품명칭 |
(2-모르폴리노페닐)메탄올 |
별명 |
(2-모르폴린-4-일페닐)메탄올 |
영문 이름 |
(2-morpholinophenyl)methanol;(2-morpholin-4-ylphenyl)methanol |
분자식 |
C11H15NO2 |
분자량 |
193.2423 |
InChI |
InChI=1/C11H15NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
cas번호 |
465514-33-4 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
녹는 점 |
54℃ |
비등점 |
362.8°C at 760 mmHg |
굴절 지수 |
1.568 |
인화점 |
173.2°C |
증기압 |
6.7E-06mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|