ChemNet > CAS > 4705-34-4 4,4'-Dimethoxystilbene
4705-34-4 4,4'-Dimethoxystilbene
| 상품명칭 |
4,4'-Dimethoxystilbene |
| 영문 이름 |
4,4'-Dimethoxystilbene; 1-methoxy-4-((E)-2-(4-methoxyphenyl)ethenyl)benzene
; 1,1'-ethene-1,2-diylbis(4-methoxybenzene); 1,1'-(E)-ethene-1,2-diylbis(4-methoxybenzene) |
| 분자식 |
C16H16O2 |
| 분자량 |
240.297 |
| InChI |
InChI=1/C16H16O2/c1-17-15-9-5-13(6-10-15)3-4-14-7-11-16(18-2)12-8-14/h3-12H,1-2H3/b4-3+ |
| cas번호 |
4705-34-4 |
| EC번호 |
225-189-9 |
| 분자 구조 |
|
| 밀도 |
1.089g/cm3 |
| 녹는 점 |
213-215℃ |
| 비등점 |
391.3°C at 760 mmHg |
| 굴절 지수 |
1.615 |
| 인화점 |
159.3°C |
| 증기압 |
5.61E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
