ChemNet > CAS > 4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid
4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid
| 상품명칭 |
2,4-Dihydroxy-3,6-dimethylbenzoic acid |
| 영문 이름 |
2,4-Dihydroxy-3,6-dimethylbenzoic acid; 3,6-Dimethyl-2,4-dihydroxybenzoic acid |
| 분자식 |
C9H10O4 |
| 분자량 |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
| cas번호 |
4707-46-4 |
| 분자 구조 |
|
| 밀도 |
1.386g/cm3 |
| 비등점 |
407.4°C at 760 mmHg |
| 굴절 지수 |
1.627 |
| 인화점 |
214.3°C |
| 증기압 |
2.29E-07mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
