ChemNet > CAS > 4707-47-5 Methyl-2,4-dihydroxy-3,6-dimethylbenzoate
4707-47-5 Methyl-2,4-dihydroxy-3,6-dimethylbenzoate
상품명칭 |
Methyl-2,4-dihydroxy-3,6-dimethylbenzoate |
영문 이름 |
Methyl-2,4-dihydroxy-3,6-dimethylbenzoate; |
분자식 |
C10H12O4 |
분자량 |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h4,11-12H,1-3H3 |
cas번호 |
4707-47-5 |
EC번호 |
225-193-0 |
분자 구조 |
|
밀도 |
1.251g/cm3 |
비등점 |
360.7°C at 760 mmHg |
굴절 지수 |
1.57 |
인화점 |
143.9°C |
증기압 |
1.05E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|