ChemNet > CAS > 4741-53-1 Tetraphenylphthalic anhydride
4741-53-1 Tetraphenylphthalic anhydride
상품명칭 |
Tetraphenylphthalic anhydride |
영문 이름 |
Tetraphenylphthalic anhydride;4,5,6,7-tetraphenyl-2-benzofuran-1,3-dione |
분자식 |
C32H20O3 |
분자량 |
452.4994 |
InChI |
InChI=1/C32H20O3/c33-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30(29)32(34)35-31)24-19-11-4-12-20-24/h1-20H |
cas번호 |
4741-53-1 |
EC번호 |
225-253-6 |
분자 구조 |
|
밀도 |
1.244g/cm3 |
비등점 |
596°C at 760 mmHg |
굴절 지수 |
1.658 |
인화점 |
290.4°C |
증기압 |
3.6E-14mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|