ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
상품명칭 |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
영문 이름 |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate; 5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
분자식 |
C11H15NO4S |
분자량 |
257.3061 |
InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
cas번호 |
4815-30-9 |
EC번호 |
225-388-0 |
분자 구조 |
|
밀도 |
1.247g/cm3 |
녹는 점 |
103-108℃ |
비등점 |
372.6°C at 760 mmHg |
굴절 지수 |
1.558 |
인화점 |
179.1°C |
증기압 |
9.51E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|