ChemNet > CAS > 4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
상품명칭 |
trans-2,3-dihydroxy-1,4-dioxane |
영문 이름 |
trans-2,3-dihydroxy-1,4-dioxane; 2,3-Dihydroxy-1,4-dioxane; Glyoxal monoethylene acetal; Dioxanediol; 1,4-dioxane-2,3-diol; trans-1,4-Dioxane-2,3-diol |
분자식 |
C4H8O4 |
분자량 |
120.1039 |
InChI |
InChI=1/C4H8O4/c5-3-4(6)8-2-1-7-3/h3-6H,1-2H2 |
cas번호 |
4845-50-5 |
EC번호 |
225-431-3 |
분자 구조 |
|
밀도 |
1.455g/cm3 |
녹는 점 |
91-95℃ |
비등점 |
259.4°C at 760 mmHg |
굴절 지수 |
1.513 |
인화점 |
110.7°C |
증기압 |
0.00189mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|