ChemNet > CAS > 485-63-2 3',4',7-Trihydroxyisoflavone
485-63-2 3',4',7-Trihydroxyisoflavone
상품명칭 |
3',4',7-Trihydroxyisoflavone |
영문 이름 |
3',4',7-Trihydroxyisoflavone;7,3',4'-Trihydroxyisoflavone; 4H-1-Benzopyran-4-one, 3-(3,4-dihydroxyphenyl)-7-hydroxy-; 3-(3,4-dihydroxyphenyl)-7-hydroxy-4H-chromen-4-one |
분자식 |
C15H10O5 |
분자량 |
270.2369 |
InChI |
InChI=1/C15H10O5/c16-9-2-3-10-14(6-9)20-7-11(15(10)19)8-1-4-12(17)13(18)5-8/h1-7,16-18H |
cas번호 |
485-63-2 |
분자 구조 |
|
밀도 |
1.548g/cm3 |
비등점 |
572.8°C at 760 mmHg |
굴절 지수 |
1.732 |
인화점 |
224°C |
증기압 |
1.01E-13mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:;
S24/25:;
|
|