486-70-4 lupinine
상품명칭 |
lupinine |
영문 이름 |
lupinine; (-)-Lupinine; (1R-trans)-Octahydro-2H-quinolizine-1-methanol; (1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol; (1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
분자식 |
C10H19NO |
분자량 |
169.264 |
InChI |
InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
cas번호 |
486-70-4 |
EC번호 |
207-638-0 |
분자 구조 |
|
밀도 |
1.04g/cm3 |
녹는 점 |
68-69℃ |
비등점 |
270°C at 760 mmHg |
굴절 지수 |
1.525 |
인화점 |
99.1°C |
증기압 |
0.000928mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|