486-84-0 Harmane
상품명칭 |
Harmane |
영문 이름 |
Harmane; 1-Methyl-9H-pyrido[3,4-b]indole; Aribine~1-Methyl-9H-pyrido[3,4-b]indole; harman; 1-methyl-9H-beta-carboline
; 2-Methyl-?carboline; Aribine; 1-methyl-9H-beta-carboline |
분자식 |
C12H10N2 |
분자량 |
182.2212 |
InChI |
InChI=1/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
cas번호 |
486-84-0 |
EC번호 |
207-642-2 |
분자 구조 |
|
밀도 |
1.252g/cm3 |
녹는 점 |
235-239℃ |
비등점 |
386.9°C at 760 mmHg |
굴절 지수 |
1.75 |
인화점 |
176.2°C |
증기압 |
7.61E-06mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S22:Do not inhale dust.;
|
|