ChemNet > CAS > 488-23-3 1,2,3,4-Tetramethylbenzene
488-23-3 1,2,3,4-Tetramethylbenzene
| 상품명칭 |
1,2,3,4-Tetramethylbenzene |
| 영문 이름 |
1,2,3,4-Tetramethylbenzene; Prehenitene; 1,2,3,4-tetramethyl-benze |
| 분자식 |
C10H14 |
| 분자량 |
134.2182 |
| InChI |
InChI=1/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
| cas번호 |
488-23-3 |
| EC번호 |
207-673-1 |
| 분자 구조 |
|
| 밀도 |
0.868g/cm3 |
| 비등점 |
204°C at 760 mmHg |
| 굴절 지수 |
1.501 |
| 인화점 |
69.7°C |
| 증기압 |
0.385mmHg at 25°C |
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|