ChemNet > CAS > 488-87-9 2,5-디메틸레조르시놀
488-87-9 2,5-디메틸레조르시놀
| 상품명칭 |
2,5-디메틸레조르시놀 |
| 별명 |
2,5- 디메틸 벤젠 -1,3- 디올 |
| 영문 이름 |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
| 분자식 |
C8H10O2 |
| 분자량 |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| cas번호 |
488-87-9 |
| EC번호 |
207-688-3 |
| 분자 구조 |
|
| 밀도 |
1.162g/cm3 |
| 녹는 점 |
161℃ |
| 비등점 |
284.1°C at 760 mmHg |
| 굴절 지수 |
1.582 |
| 인화점 |
140.8°C |
| 증기압 |
0.00178mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
