488-87-9 2,5-디메틸레조르시놀
상품명칭 |
2,5-디메틸레조르시놀 |
별명 |
2,5- 디메틸 벤젠 -1,3- 디올 |
영문 이름 |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
분자식 |
C8H10O2 |
분자량 |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
cas번호 |
488-87-9 |
EC번호 |
207-688-3 |
분자 구조 |
|
밀도 |
1.162g/cm3 |
녹는 점 |
161℃ |
비등점 |
284.1°C at 760 mmHg |
굴절 지수 |
1.582 |
인화점 |
140.8°C |
증기압 |
0.00178mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|