ChemNet > CAS > 4884-24-6 Cyclopentylcyclopentanon
4884-24-6 Cyclopentylcyclopentanon
상품명칭 |
Cyclopentylcyclopentanon |
영문 이름 |
Cyclopentylcyclopentanon; 2-Cyclopentylcyclopentanone; 1,1'-bi(cyclopentyl)-2-one |
분자식 |
C10H16O |
분자량 |
152.2334 |
InChI |
InChI=1/C10H16O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h8-9H,1-7H2 |
cas번호 |
4884-24-6 |
EC번호 |
225-495-2 |
분자 구조 |
|
밀도 |
1.031g/cm3 |
비등점 |
232.5°C at 760 mmHg |
굴절 지수 |
1.512 |
인화점 |
90.3°C |
증기압 |
0.0588mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|