ChemNet > CAS > 491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
491-54-3 4'-Methoxy-3,5,7-trihydroxyflavone
| 상품명칭 |
4'-Methoxy-3,5,7-trihydroxyflavone |
| 영문 이름 |
4'-Methoxy-3,5,7-trihydroxyflavone; Kaempferide; 3,5,7-Trihydroxy-4-methoxyflavone; 3,5,7-trihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| 분자식 |
C16H12O6 |
| 분자량 |
300.2629 |
| InChI |
InChI=1/C16H12O6/c1-21-10-4-2-8(3-5-10)16-15(20)14(19)13-11(18)6-9(17)7-12(13)22-16/h2-7,17-18,20H,1H3 |
| cas번호 |
491-54-3 |
| EC번호 |
207-738-4 |
| 분자 구조 |
|
| 밀도 |
1.538g/cm3 |
| 비등점 |
543.8°C at 760 mmHg |
| 굴절 지수 |
1.709 |
| 인화점 |
207.1°C |
| 증기압 |
1.94E-12mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
