ChemNet > CAS > 491-78-1 Primuletin
491-78-1 Primuletin
상품명칭 |
Primuletin |
영문 이름 |
Primuletin; 5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
분자식 |
C15H10O3 |
분자량 |
238.2381 |
InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
cas번호 |
491-78-1 |
EC번호 |
207-743-1 |
분자 구조 |
|
밀도 |
1.34g/cm3 |
비등점 |
425°C at 760 mmHg |
굴절 지수 |
1.666 |
인화점 |
165.4°C |
증기압 |
7.97E-08mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|