ChemNet > CAS > 4916-57-8 1,2-Bis(4-pyridyl)ethane
4916-57-8 1,2-Bis(4-pyridyl)ethane
상품명칭 |
1,2-Bis(4-pyridyl)ethane |
영문 이름 |
1,2-Bis(4-pyridyl)ethane; |
분자식 |
C12H12N2 |
분자량 |
184.2371 |
InChI |
InChI=1/C12H12N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h3-10H,1-2H2 |
cas번호 |
4916-57-8 |
EC번호 |
225-543-2 |
분자 구조 |
|
밀도 |
1.087g/cm3 |
녹는 점 |
107-113℃ |
비등점 |
310.3°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
117.2°C |
증기압 |
0.00111mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|