4917-76-4 thiodi(succinic acid)
상품명칭 |
thiodi(succinic acid) |
영문 이름 |
thiodi(succinic acid); Thiodisuccinicacid; Thiodisuccinic acid; 2,2'-sulfanediyldibutanedioic acid |
분자식 |
C7H5FN2 |
분자량 |
136.1264 |
InChI |
InChI=1/C7H5FN2/c8-6-2-4-10-7-5(6)1-3-9-7/h1-4H,(H,9,10) |
cas번호 |
4917-76-4 |
EC번호 |
225-544-8 |
분자 구조 |
|
밀도 |
1.371g/cm3 |
굴절 지수 |
1.659 |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|