ChemNet > CAS > 4920-34-7 2,3,6-Trifluoroanisole
4920-34-7 2,3,6-Trifluoroanisole
상품명칭 |
2,3,6-Trifluoroanisole |
영문 이름 |
2,3,6-Trifluoroanisole; 3-Methoxy-1,2,4-trifluorobenzene; 1,2,4-trifluoro-3-methoxybenzene |
분자식 |
C7H5F3O |
분자량 |
162.1092 |
InChI |
InChI=1/C7H5F3O/c1-11-7-5(9)3-2-4(8)6(7)10/h2-3H,1H3 |
cas번호 |
4920-34-7 |
분자 구조 |
|
밀도 |
1.285g/cm3 |
비등점 |
147.7°C at 760 mmHg |
굴절 지수 |
1.435 |
인화점 |
49.1°C |
증기압 |
5.53mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|