상품명칭 |
3,3',4,4'-Tetramethylbiphenyl |
영문 이름 |
3,3',4,4'-Tetramethylbiphenyl;3,3',4,4'-Tetramethyl-1,1'-biphenyl; 3,3',4,4'-Tetramethyldiphenyl; 3,4,3',4'-Tetramethylbiphenyl; 4-05-00-01956 (Beilstein Handbook Reference); BRN 1935370; 1,1'-Biphenyl, 3,3',4,4'-tetramethyl- (9CI); Biphenyl, 3,3',4,4'-tetramethyl- |
분자식 |
C16H18 |
분자량 |
210.3141 |
InChI |
InChI=1/C16H18/c1-11-5-7-15(9-13(11)3)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3 |
cas번호 |
4920-95-0 |
분자 구조 |
|
밀도 |
0.956g/cm3 |
비등점 |
317.5°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
151.6°C |
증기압 |
0.000715mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|