ChemNet > CAS > 4938-52-7 1-Hepten-3-ol
4938-52-7 1-Hepten-3-ol
| 상품명칭 |
1-Hepten-3-ol |
| 영문 이름 |
1-Hepten-3-ol; n-Butyl vinyl carbinol; hept-1-en-3-ol; (3S)-hept-1-en-3-ol |
| 분자식 |
C7H14O |
| 분자량 |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-3-5-6-7(8)4-2/h4,7-8H,2-3,5-6H2,1H3/t7-/m1/s1 |
| cas번호 |
4938-52-7 |
| EC번호 |
225-579-9 |
| 분자 구조 |
|
| 밀도 |
0.833g/cm3 |
| 비등점 |
154.5°C at 760 mmHg |
| 굴절 지수 |
1.434 |
| 인화점 |
48.8°C |
| 증기압 |
1.16mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
