ChemNet > CAS > 498-74-8 4-Methoxymetanilyl fluoride
498-74-8 4-Methoxymetanilyl fluoride
상품명칭 |
4-Methoxymetanilyl fluoride |
영문 이름 |
4-Methoxymetanilyl fluoride; 3-amino-4-methoxyphenylsulphonyl fluoride; Aminomethoxybenzenesulfonylfluoride; 3-Amino-4-methoxAV21428; 3-amino-4-methoxybenzenesulfonyl fluoride; 3-fluorobenzohydrazide |
분자식 |
C7H7FN2O |
분자량 |
154.1417 |
InChI |
InChI=1/C7H7FN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
cas번호 |
498-74-8 |
EC번호 |
207-870-2 |
분자 구조 |
|
밀도 |
1.272g/cm3 |
녹는 점 |
60-65℃ |
비등점 |
312.6°C at 760 mmHg |
굴절 지수 |
1.552 |
인화점 |
142.8°C |
증기압 |
0.000224mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|