ChemNet > CAS > 499785-52-3 ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate
499785-52-3 ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate
상품명칭 |
ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate |
영문 이름 |
ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate; ethyl 1-methyl-1H-benzo[d][1,2,3]triazole-5-carboxylate; ethyl 1-methylbenzotriazole-5-carboxylate |
분자식 |
C10H11N3O2 |
분자량 |
205.2132 |
InChI |
InChI=1/C10H11N3O2/c1-3-15-10(14)7-4-5-9-8(6-7)11-12-13(9)2/h4-6H,3H2,1-2H3 |
cas번호 |
499785-52-3 |
분자 구조 |
|
밀도 |
1.292g/cm3 |
녹는 점 |
98℃ |
비등점 |
356.961°C at 760 mmHg |
굴절 지수 |
1.616 |
인화점 |
169.684°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|