50-66-8 6-(Methylthio)purine
상품명칭 |
6-(Methylthio)purine |
영문 이름 |
6-(Methylthio)purine; 6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
분자식 |
C6H6N4S |
분자량 |
166.2036 |
InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
cas번호 |
50-66-8 |
EC번호 |
200-057-3 |
분자 구조 |
|
밀도 |
1.59g/cm3 |
녹는 점 |
221-222℃ |
비등점 |
290.9°C at 760 mmHg |
굴절 지수 |
1.806 |
인화점 |
129.7°C |
증기압 |
0.00351mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|