50262-67-4 p-Nonyloxyaniline
상품명칭 |
p-Nonyloxyaniline |
영문 이름 |
p-Nonyloxyaniline; 4-n-Nonyloxyaniline; 4-(nonyloxy)aniline |
분자식 |
C15H25NO |
분자량 |
235.3651 |
InChI |
InChI=1/C15H25NO/c1-2-3-4-5-6-7-8-13-17-15-11-9-14(16)10-12-15/h9-12H,2-8,13,16H2,1H3 |
cas번호 |
50262-67-4 |
분자 구조 |
|
밀도 |
0.949g/cm3 |
비등점 |
356.5°C at 760 mmHg |
굴절 지수 |
1.511 |
인화점 |
159.3°C |
증기압 |
2.91E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|