ChemNet > CAS > 5033-28-3 4-chloro-N'-hydroxybenzenecarboximidamide
5033-28-3 4-chloro-N'-hydroxybenzenecarboximidamide
상품명칭 |
4-chloro-N'-hydroxybenzenecarboximidamide |
영문 이름 |
4-chloro-N'-hydroxybenzenecarboximidamide; (Z)-4-chloro-N'-hydroxybenzamidine |
분자식 |
C7H7ClN2O |
분자량 |
170.5963 |
InChI |
InChI=1/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H,(H2,9,10) |
cas번호 |
5033-28-3 |
분자 구조 |
|
밀도 |
1.368g/cm3 |
녹는 점 |
129℃ |
비등점 |
334.619°C at 760 mmHg |
굴절 지수 |
1.6 |
인화점 |
156.172°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|