상품명칭 |
2,4-디아미노-s-트리아진 |
별명 |
;D 이아미노 트리아진; 1,3,5-트리아진-2,4-디아민; 2,4-디아미노-1,3,5-트리아진 |
영문 이름 |
2,4-Diamino-s-triazine; Diaminotriazine; 1,3,5-triazine-2,4-diamine; 2,4-Diamino-1,3,5-Triazine |
분자식 |
C3H5N5 |
분자량 |
111.1053 |
InChI |
InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
cas번호 |
504-08-5 |
EC번호 |
207-983-7 |
분자 구조 |
|
밀도 |
1.508g/cm3 |
비등점 |
447.6°C at 760 mmHg |
굴절 지수 |
1.716 |
인화점 |
254.9°C |
증기압 |
3.32E-08mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|