ChemNet > CAS > 505-54-4 Hexadecanedioic acid
505-54-4 Hexadecanedioic acid
| 상품명칭 |
Hexadecanedioic acid |
| 영문 이름 |
Hexadecanedioic acid; Thapsic acid; 1,16-Hexadecanedioic acid; Hexadecane Diacid; hexadecanedioate |
| 분자식 |
C16H28O4 |
| 분자량 |
284.3922 |
| InChI |
InChI=1/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20)/p-2 |
| cas번호 |
505-54-4 |
| EC번호 |
208-013-5 |
| 분자 구조 |
|
| 녹는 점 |
120-123℃ |
| 비등점 |
457.5°C at 760 mmHg |
| 인화점 |
244.6°C |
| 증기압 |
1.22E-09mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
