ChemNet > CAS > 5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
5081-42-5 Methyl 2-nitro-3,4,5-trimethoxybenzoate
상품명칭 |
Methyl 2-nitro-3,4,5-trimethoxybenzoate |
영문 이름 |
Methyl 2-nitro-3,4,5-trimethoxybenzoate; 2-Nitro-3,4,5-trimethoxybenzoic acid methyl ester; methyl 3,4,5-trimethoxy-2-nitrobenzoate |
분자식 |
C11H13NO7 |
분자량 |
271.2234 |
InChI |
InChI=1/C11H13NO7/c1-16-7-5-6(11(13)19-4)8(12(14)15)10(18-3)9(7)17-2/h5H,1-4H3 |
cas번호 |
5081-42-5 |
EC번호 |
225-794-8 |
분자 구조 |
|
밀도 |
1.284g/cm3 |
비등점 |
420°C at 760 mmHg |
굴절 지수 |
1.523 |
인화점 |
188.9°C |
증기압 |
2.9E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|