ChemNet > CAS > 50995-74-9 7-(diethylamino)coumarin-3-carboxylic acid
50995-74-9 7-(diethylamino)coumarin-3-carboxylic acid
상품명칭 |
7-(diethylamino)coumarin-3-carboxylic acid |
영문 이름 |
7-(diethylamino)coumarin-3-carboxylic acid; 7-Diethylaminocoumarin-3-carboxylic acid; 7-(Diethylamino)-2-oxo-2H-chromene-3-carboxylic acid; 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzaldehyde |
분자식 |
C14H15NO4 |
분자량 |
261.2732 |
InChI |
InChI=1/C14H15NO4/c1-9-12(10(2)19-15-9)8-18-13-5-4-11(7-16)6-14(13)17-3/h4-7H,8H2,1-3H3 |
cas번호 |
50995-74-9 |
분자 구조 |
|
밀도 |
1.196g/cm3 |
녹는 점 |
222℃ |
비등점 |
438.2°C at 760 mmHg |
굴절 지수 |
1.562 |
인화점 |
218.8°C |
증기압 |
7.04E-08mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|