51-49-0 D-Thyroxine
상품명칭 |
D-Thyroxine |
영문 이름 |
D-Thyroxine; D-4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzylalanine; D-thyroxine free acid; O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine; O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-D-tyrosine |
분자식 |
C16H13I4NO4 |
분자량 |
790.8966 |
InChI |
InChI=1/C16H13I4NO4/c1-7(16(23)24)21-6-8-2-12(19)15(13(20)3-8)25-9-4-10(17)14(22)11(18)5-9/h2-5,7,21-22H,6H2,1H3,(H,23,24)/t7-/m1/s1 |
cas번호 |
51-49-0 |
EC번호 |
200-102-7 |
분자 구조 |
|
녹는 점 |
225℃ |
굴절 지수 |
1.759 |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|