| 상품명칭 |
4-(4-클로로페닐)-1,2,3,6-테트라히드로피리딘 염산염 |
| 별명 |
; 4-(4-클로로페닐)-1,2,3,6-테트라하이드로-피리딘 HCl; 4-(4-클로로 페닐)1,2,3-테트라 하이드로피리딘 HCL; 4-(4-클로로페닐)-1,2,3,6-테트라히드로피리디늄 |
| 영문 이름 |
4-(4-Chlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride; 4-(4-Chlorophenyl)-1,2,3,6-tetrahydro-pyridine HCl; 4-(4-Chloro Phenyl)1,2,3-Tetra Hydropyridine HCL; 4-(4-chlorophenyl)-1,2,3,6-tetrahydropyridinium |
| 분자식 |
C11H13ClN |
| 분자량 |
194.6801 |
| InChI |
InChI=1/C11H12ClN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2/p+1 |
| cas번호 |
51304-61-1 |
| EC번호 |
257-126-6 |
| 분자 구조 |
|
| 녹는 점 |
199-204℃ |
| 비등점 |
296.5°C at 760 mmHg |
| 인화점 |
133.1°C |
| 증기압 |
0.00143mmHg at 25°C |
| 위험성 표시 |
T:Toxic;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|