ChemNet > CAS > 5139-89-9 4-Phenoxybutyryl chloride
5139-89-9 4-Phenoxybutyryl chloride
상품명칭 |
4-Phenoxybutyryl chloride |
영문 이름 |
4-Phenoxybutyryl chloride;4-phenoxybutanoyl chloride |
분자식 |
C10H11ClO2 |
분자량 |
198.6461 |
InChI |
InChI=1/C10H11ClO2/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
cas번호 |
5139-89-9 |
EC번호 |
225-903-9 |
분자 구조 |
|
밀도 |
1.158g/cm3 |
비등점 |
297.1°C at 760 mmHg |
굴절 지수 |
1.515 |
인화점 |
110.6°C |
증기압 |
0.00138mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|