5139-89-9 4-Phenoxybutyryl chloride

상품명칭	4-Phenoxybutyryl chloride
영문 이름	4-Phenoxybutyryl chloride;4-phenoxybutanoyl chloride
분자식	C₁₀H₁₁ClO₂
분자량	198.6461
InChI	InChI=1/C10H11ClO2/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2
cas번호	5139-89-9
EC번호	225-903-9
분자 구조
밀도	1.158g/cm³
비등점	297.1°C at 760 mmHg
굴절 지수	1.515
인화점	110.6°C
증기압	0.00138mmHg at 25°C
위험성 표시
리스크 규칙	R34:Causes burns.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;