ChemNet > CAS > 51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
51516-67-7 5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
| 상품명칭 |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| 영문 이름 |
5-amino-1-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile; |
| 분자식 |
C10H7ClN4 |
| 분자량 |
218.6424 |
| InChI |
InChI=1/C10H7ClN4/c11-8-1-3-9(4-2-8)15-10(13)7(5-12)6-14-15/h1-4,6H,13H2 |
| cas번호 |
51516-67-7 |
| 분자 구조 |
|
| 밀도 |
1.41g/cm3 |
| 녹는 점 |
170℃ |
| 비등점 |
424.2°C at 760 mmHg |
| 굴절 지수 |
1.686 |
| 인화점 |
210.4°C |
| 증기압 |
2.1E-07mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
