ChemNet > CAS > 51560-21-5 Benzene, 1,4-diiodo-2,5-dimethoxy-
51560-21-5 Benzene, 1,4-diiodo-2,5-dimethoxy-
| 상품명칭 |
Benzene, 1,4-diiodo-2,5-dimethoxy- |
| 영문 이름 |
Benzene, 1,4-diiodo-2,5-dimethoxy-; 1,4-Diiodo-2,5-dimethoxybenzene |
| 분자식 |
C8H8I2O2 |
| 분자량 |
389.9569 |
| InChI |
InChI=1/C8H8I2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| cas번호 |
51560-21-5 |
| 분자 구조 |
|
| 밀도 |
2.147g/cm3 |
| 녹는 점 |
171℃ |
| 비등점 |
382.9°C at 760 mmHg |
| 굴절 지수 |
1.64 |
| 인화점 |
185.4°C |
| 증기압 |
1.01E-05mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
