ChemNet > CAS > 51627-47-5 2-모르폴리노-3-피리디나민
51627-47-5 2-모르폴리노-3-피리디나민
| 상품명칭 |
2-모르폴리노-3-피리디나민 |
| 별명 |
2-모르폴린-4-일피리딘-3-아민; 3-아미노-2-모르폴린-4-일피리디늄 |
| 영문 이름 |
2-morpholino-3-pyridinamine;2-morpholin-4-ylpyridin-3-amine; 3-amino-2-morpholin-4-ylpyridinium |
| 분자식 |
C9H14N3O |
| 분자량 |
180.2264 |
| InChI |
InChI=1/C9H13N3O/c10-8-2-1-3-11-9(8)12-4-6-13-7-5-12/h1-3H,4-7,10H2/p+1 |
| cas번호 |
51627-47-5 |
| 분자 구조 |
|
| 비등점 |
381.9°C at 760 mmHg |
| 인화점 |
184.8°C |
| 증기압 |
4.91E-06mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
