ChemNet > CAS > 519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde
519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde
상품명칭 |
2-Carboxy-3,4-dimethoxybenzaldehyde |
영문 이름 |
2-Carboxy-3,4-dimethoxybenzaldehyde; 5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid; 6-formyl-2,3-dimethoxybenzoic acid |
분자식 |
C10H10O5 |
분자량 |
210.1834 |
InChI |
InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
cas번호 |
519-05-1 |
EC번호 |
208-261-4 |
분자 구조 |
|
밀도 |
1.3g/cm3 |
비등점 |
386.3°C at 760 mmHg |
굴절 지수 |
1.573 |
인화점 |
155.1°C |
증기압 |
1.17E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|