ChemNet > CAS > 5197-28-4 2-Bromo-4-nitroanisole
5197-28-4 2-Bromo-4-nitroanisole
| 상품명칭 |
2-Bromo-4-nitroanisole |
| 영문 이름 |
2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-; 2-bromo-1-methoxy-4-nitrobenzene |
| 분자식 |
C7H6BrNO3 |
| 분자량 |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| cas번호 |
5197-28-4 |
| EC번호 |
225-983-5 |
| 분자 구조 |
|
| 밀도 |
1.64g/cm3 |
| 녹는 점 |
104-106℃ |
| 비등점 |
306.3°C at 760 mmHg |
| 굴절 지수 |
1.581 |
| 인화점 |
139.1°C |
| 증기압 |
0.00141mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
