상품명칭 |
Hesperetin |
영문 이름 |
Hesperetin; 3,5,7-Trihydroxy-4-methoxyflavanone; 4-Methoxy-3,5,7-trihydroxyflavanone; Hesperin; 3',5,7-Trihydroxy-4'-methoxyflavanone; 4'-Methoxy-3',5,7-trihydroxyflavanone; Hesperetine; Hesperitin
; 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one; (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydro-4H-chromen-4-one |
분자식 |
C16H14O6 |
분자량 |
302.2788 |
InChI |
InChI=1/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
cas번호 |
520-33-2;41001-90-5 |
EC번호 |
208-290-2 |
분자 구조 |
|
밀도 |
1.458g/cm3 |
비등점 |
586.2°C at 760 mmHg |
굴절 지수 |
1.664 |
인화점 |
223°C |
증기압 |
2.45E-14mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|